C18H12F3N3O3S — CID 22238919
N-[4-(cyanomethyl)phenyl]-2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonamide (PubChem CID 22238919) has the molecular formula C18H12F3N3O3S and a molecular weight of 407.37 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 22238919 |
| Molecular Formula | C18H12F3N3O3S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-oxo-4-(trifluoromethyl)-1H-quinoline-6-sulfonamide |
| SMILES | N#CCc1ccc(NS(=O)(=O)c2ccc3[nH]c(=O)cc(C(F)(F)F)c3c2)cc1 |
| InChI | InChI=1S/C18H12F3N3O3S/c19-18(20,21)15-10-17(25)23-16-6-5-13(9-14(15)16)28(26,27)24-12-3-1-11(2-4-12)7-8-22/h1-6,9-10,24H,7H2,(H,23,25) |
| InChIKey | QYCDFVVUUNJIFB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |