C20H15F3N2O3S — CID 2223913
N-(2,6-difluorophenyl)-2-(N-(4-fluorophenyl)sulfonylanilino)acetamide (PubChem CID 2223913) has the molecular formula C20H15F3N2O3S and a molecular weight of 420.41 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(N-(4-fluorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(N-(4-fluorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2223913 |
| Molecular Formula | C20H15F3N2O3S |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(N-(4-fluorophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccc(F)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C20H15F3N2O3S/c21-14-9-11-16(12-10-14)29(27,28)25(15-5-2-1-3-6-15)13-19(26)24-20-17(22)7-4-8-18(20)23/h1-12H,13H2,(H,24,26) |
| InChIKey | AEVQUBRBGUKKMI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |