About 2,3-dimethylaniline;hydrochloride
2,3-dimethylaniline;hydrochloride (PubChem CID 22239262) has the molecular formula C8H12ClN
and a molecular weight of 157.64 g/mol. Its IUPAC name is 2,3-dimethylaniline;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dimethylaniline;hydrochloride |
| PubChem CID | 22239262 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 2,3-dimethylaniline;hydrochloride |
| SMILES | Cc1cccc(N)c1C.Cl |
| InChI | InChI=1S/C8H11N.ClH/c1-6-4-3-5-8(9)7(6)2;/h3-5H,9H2,1-2H3;1H |
| InChIKey | DUQDEEVOZDZJGQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylaniline;hydrochloride?
The IUPAC name of 2,3-dimethylaniline;hydrochloride (CID 22239262) is 2,3-dimethylaniline;hydrochloride.
What is the SMILES notation for 2,3-dimethylaniline;hydrochloride?
The canonical SMILES for 2,3-dimethylaniline;hydrochloride is Cc1cccc(N)c1C.Cl.
What is the InChIKey of 2,3-dimethylaniline;hydrochloride?
The InChIKey is DUQDEEVOZDZJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.ClH/c1-6-4-3-5-8(9)7(6)2;/h3-5H,9H2,1-2H3;1H.
What are the key properties of 2,3-dimethylaniline;hydrochloride?
2,3-dimethylaniline;hydrochloride has a molecular weight of 157.64 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylaniline;hydrochloride is sourced from PubChem (CID 22239262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).