About 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione
2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione (PubChem CID 22239265) has the molecular formula C26H34N2O2
and a molecular weight of 406.57 g/mol. Its IUPAC name is 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione.
Molecular Properties
| Compound Name | 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione |
| PubChem CID | 22239265 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione |
| SMILES | CCN(CC)c1ccc(C2CC(=O)CC(c3ccc(N(CC)CC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-5-27(6-2)21-13-9-19(10-14-21)24-17-23(29)18-25(26(24)30)20-11-15-22(16-12-20)28(7-3)8-4/h9-16,24-25H,5-8,17-18H2,1-4H3 |
| InChIKey | LOUUUIRQEASJRA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione?
The IUPAC name of 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione (CID 22239265) is 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione.
What is the SMILES notation for 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione?
The canonical SMILES for 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione is CCN(CC)c1ccc(C2CC(=O)CC(c3ccc(N(CC)CC)cc3)C2=O)cc1.
What is the InChIKey of 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione?
The InChIKey is LOUUUIRQEASJRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34N2O2/c1-5-27(6-2)21-13-9-19(10-14-21)24-17-23(29)18-25(26(24)30)20-11-15-22(16-12-20)28(7-3)8-4/h9-16,24-25H,5-8,17-18H2,1-4H3.
What are the key properties of 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione?
2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione has a molecular weight of 406.57 g/mol, XLogP of 5.18, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis[4-(diethylamino)phenyl]cyclohexane-1,4-dione is sourced from PubChem (CID 22239265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).