About 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol
3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol (PubChem CID 22239484) has the molecular formula C18H40O4
and a molecular weight of 320.51 g/mol. Its IUPAC name is 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol.
Molecular Properties
| Compound Name | 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol |
| PubChem CID | 22239484 |
| Molecular Formula | C18H40O4 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol |
| SMILES | CCCC(CC)(CCO)CCO.CCCC(CC)(CO)CO |
| InChI | InChI=1S/C10H22O2.C8H18O2/c1-3-5-10(4-2,6-8-11)7-9-12;1-3-5-8(4-2,6-9)7-10/h11-12H,3-9H2,1-2H3;9-10H,3-7H2,1-2H3 |
| InChIKey | AKOVWBORQSXFCA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol?
The IUPAC name of 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol (CID 22239484) is 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol.
What is the SMILES notation for 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol?
The canonical SMILES for 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol is CCCC(CC)(CCO)CCO.CCCC(CC)(CO)CO.
What is the InChIKey of 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol?
The InChIKey is AKOVWBORQSXFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O2.C8H18O2/c1-3-5-10(4-2,6-8-11)7-9-12;1-3-5-8(4-2,6-9)7-10/h11-12H,3-9H2,1-2H3;9-10H,3-7H2,1-2H3.
What are the key properties of 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol?
3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol has a molecular weight of 320.51 g/mol, XLogP of 3.12, 12 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-propylpentane-1,5-diol;2-ethyl-2-propylpropane-1,3-diol is sourced from PubChem (CID 22239484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).