C15H23F3IO3S- — CID 22239513
ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate (PubChem CID 22239513) has the molecular formula C15H23F3IO3S- and a molecular weight of 467.31 g/mol. Its IUPAC name is ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate.
| Compound Name | ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22239513 |
| Molecular Formula | C15H23F3IO3S- |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate |
| SMILES | CC(C)(C)I(c1ccccc1)C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H23I.CHF3O3S/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;2-1(3,4)8(5,6)7/h7-11H,1-6H3;(H,5,6,7)/p-1 |
| InChIKey | ZFCQCHVKJANHEH-UHFFFAOYSA-M |
| XLogP | 5.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|