About ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate
ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate (PubChem CID 22239513) has the molecular formula C15H23F3IO3S-
and a molecular weight of 467.31 g/mol. Its IUPAC name is ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate |
| PubChem CID | 22239513 |
| Molecular Formula | C15H23F3IO3S- |
| Molecular Weight | 467.31 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate |
| SMILES | CC(C)(C)I(c1ccccc1)C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C14H23I.CHF3O3S/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;2-1(3,4)8(5,6)7/h7-11H,1-6H3;(H,5,6,7)/p-1 |
| InChIKey | ZFCQCHVKJANHEH-UHFFFAOYSA-M |
| XLogP | 5.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.31 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate?
The IUPAC name of ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate (CID 22239513) is ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate.
What is the SMILES notation for ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate?
The canonical SMILES for ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate is CC(C)(C)I(c1ccccc1)C(C)(C)C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate?
The InChIKey is ZFCQCHVKJANHEH-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H23I.CHF3O3S/c1-13(2,3)15(14(4,5)6)12-10-8-7-9-11-12;2-1(3,4)8(5,6)7/h7-11H,1-6H3;(H,5,6,7)/p-1.
What are the key properties of ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate?
ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate has a molecular weight of 467.31 g/mol, XLogP of 5.01, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(phenyl)-λ3-iodane;trifluoromethanesulfonate is sourced from PubChem (CID 22239513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).