C30H15BF19O2Si- — CID 22239752
[4-[diethoxy(ethyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 22239752) has the molecular formula C30H15BF19O2Si- and a molecular weight of 807.31 g/mol. Its IUPAC name is [4-[diethoxy(ethyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-[diethoxy(ethyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 22239752 |
| Molecular Formula | C30H15BF19O2Si- |
| Molecular Weight | 807.31 g/mol |
| Exact Mass | 807.06 |
| IUPAC Name | [4-[diethoxy(ethyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCO[Si](CC)(OCC)c1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H15BF19O2Si/c1-4-51-53(6-3,52-5-2)30-28(49)17(38)10(18(39)29(30)50)31(7-11(32)19(40)25(46)20(41)12(7)33,8-13(34)21(42)26(47)22(43)14(8)35)9-15(36)23(44)27(48)24(45)16(9)37/h4-6H2,1-3H3/q-1 |
| InChIKey | GAVKQIIULXTZKZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.31 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|