C36H33BF15NO — CID 22239776
(4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium (PubChem CID 22239776) has the molecular formula C36H33BF15NO and a molecular weight of 791.45 g/mol. Its IUPAC name is (4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium.
| Compound Name | (4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium |
|---|---|
| PubChem CID | 22239776 |
| Molecular Formula | C36H33BF15NO |
| Molecular Weight | 791.45 g/mol |
| Exact Mass | 791.24 |
| IUPAC Name | (4-hydroxyphenyl)-tris(2,3,4,5,6-pentafluorophenyl)boranuide;tributylazanium |
| SMILES | CCCC[NH+](CCCC)CCCC.Oc1ccc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C24H5BF15O.C12H27N/c26-10-7(11(27)17(33)22(38)16(10)32)25(5-1-3-6(41)4-2-5,8-12(28)18(34)23(39)19(35)13(8)29)9-14(30)20(36)24(40)21(37)15(9)31;1-4-7-10-13(11-8-5-2)12-9-6-3/h1-4,41H;4-12H2,1-3H3/q-1;/p+1 |
| InChIKey | HFCRVCCBKVAQMW-UHFFFAOYSA-O |
| XLogP | 7.13 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.45 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|