C45H25BClF15Si — CID 22239783
[4-[chloro(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide;diphenylmethylbenzene (PubChem CID 22239783) has the molecular formula C45H25BClF15Si and a molecular weight of 925.02 g/mol. Its IUPAC name is [4-[chloro(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide;diphenylmethylbenzene.
| Compound Name | [4-[chloro(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide;diphenylmethylbenzene |
|---|---|
| PubChem CID | 22239783 |
| Molecular Formula | C45H25BClF15Si |
| Molecular Weight | 925.02 g/mol |
| Exact Mass | 924.13 |
| IUPAC Name | [4-[chloro(dimethyl)silyl]phenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide;diphenylmethylbenzene |
| SMILES | C[Si](C)(Cl)c1ccc([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)cc1.c1ccc([C+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H10BClF15Si.C19H15/c1-44(2,28)8-5-3-7(4-6-8)27(9-12(29)18(35)24(41)19(36)13(9)30,10-14(31)20(37)25(42)21(38)15(10)32)11-16(33)22(39)26(43)23(40)17(11)34;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h3-6H,1-2H3;1-15H/q-1;+1 |
| InChIKey | WPUIQDOQQUIGPM-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.02 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|