C29H13BF19O2Si- — CID 22239818
[4-[diethoxy(methyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 22239818) has the molecular formula C29H13BF19O2Si- and a molecular weight of 793.28 g/mol. Its IUPAC name is [4-[diethoxy(methyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | [4-[diethoxy(methyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 22239818 |
| Molecular Formula | C29H13BF19O2Si- |
| Molecular Weight | 793.28 g/mol |
| Exact Mass | 793.05 |
| IUPAC Name | [4-[diethoxy(methyl)silyl]-2,3,5,6-tetrafluorophenyl]-tris(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCO[Si](C)(OCC)c1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C29H13BF19O2Si/c1-4-50-52(3,51-5-2)29-27(48)16(37)9(17(38)28(29)49)30(6-10(31)18(39)24(45)19(40)11(6)32,7-12(33)20(41)25(46)21(42)13(7)34)8-14(35)22(43)26(47)23(44)15(8)36/h4-5H2,1-3H3/q-1 |
| InChIKey | GILGFDQLYKZNDE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.28 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|