C6H9N5O — CID 22239906
2-amino-3,4a,5,8-tetrahydro-2H-pteridin-4-one (PubChem CID 22239906) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-amino-3,4a,5,8-tetrahydro-2H-pteridin-4-one.
| Compound Name | 2-amino-3,4a,5,8-tetrahydro-2H-pteridin-4-one |
|---|---|
| PubChem CID | 22239906 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-amino-3,4a,5,8-tetrahydro-2H-pteridin-4-one |
| SMILES | NC1N=C2NC=CNC2C(=O)N1 |
| InChI | InChI=1S/C6H9N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1-3,6,8H,7H2,(H,9,10)(H,11,12) |
| InChIKey | PTTQRGVQEQAJRJ-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |