About 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one
6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one (PubChem CID 22239943) has the molecular formula C12H18N4OS
and a molecular weight of 266.37 g/mol. Its IUPAC name is 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one.
Molecular Properties
| Compound Name | 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one |
| PubChem CID | 22239943 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one |
| SMILES | CCCc1nc2c([nH]1)c(SC)nc(=O)n2CCC |
| InChI | InChI=1S/C12H18N4OS/c1-4-6-8-13-9-10(14-8)16(7-5-2)12(17)15-11(9)18-3/h4-7H2,1-3H3,(H,13,14) |
| InChIKey | DKSOKICEFUQLBN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one?
The IUPAC name of 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one (CID 22239943) is 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one.
What is the SMILES notation for 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one?
The canonical SMILES for 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one is CCCc1nc2c([nH]1)c(SC)nc(=O)n2CCC.
What is the InChIKey of 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one?
The InChIKey is DKSOKICEFUQLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4OS/c1-4-6-8-13-9-10(14-8)16(7-5-2)12(17)15-11(9)18-3/h4-7H2,1-3H3,(H,13,14).
What are the key properties of 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one?
6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one has a molecular weight of 266.37 g/mol, XLogP of 2.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfanyl-3,8-dipropyl-7H-purin-2-one is sourced from PubChem (CID 22239943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).