C13H8F3N5O2 — CID 22240094
7-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazine (PubChem CID 22240094) has the molecular formula C13H8F3N5O2 and a molecular weight of 323.23 g/mol. Its IUPAC name is 7-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazine.
| Compound Name | 7-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 22240094 |
| Molecular Formula | C13H8F3N5O2 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 7-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)imidazo[1,2-b][1,2,4]triazine |
| SMILES | Cc1ccc(-c2cnc3nc(C(F)(F)F)cnn23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H8F3N5O2/c1-7-2-3-8(4-9(7)21(22)23)10-5-17-12-19-11(13(14,15)16)6-18-20(10)12/h2-6H,1H3 |
| InChIKey | XKTQPPGIOVXXPI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|