About 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea
1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea (PubChem CID 22240322) has the molecular formula C21H22N4O3
and a molecular weight of 378.43 g/mol. Its IUPAC name is 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea.
Molecular Properties
| Compound Name | 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea |
| PubChem CID | 22240322 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea |
| SMILES | COc1ccccc1-c1cc2cnccc2nc1NC(=O)NC1CCCCO1 |
| InChI | InChI=1S/C21H22N4O3/c1-27-18-7-3-2-6-15(18)16-12-14-13-22-10-9-17(14)23-20(16)25-21(26)24-19-8-4-5-11-28-19/h2-3,6-7,9-10,12-13,19H,4-5,8,11H2,1H3,(H2,23,24,25,26) |
| InChIKey | JJNYEMHUPDSTOB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea?
The IUPAC name of 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea (CID 22240322) is 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea.
What is the SMILES notation for 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea?
The canonical SMILES for 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea is COc1ccccc1-c1cc2cnccc2nc1NC(=O)NC1CCCCO1.
What is the InChIKey of 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea?
The InChIKey is JJNYEMHUPDSTOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O3/c1-27-18-7-3-2-6-15(18)16-12-14-13-22-10-9-17(14)23-20(16)25-21(26)24-19-8-4-5-11-28-19/h2-3,6-7,9-10,12-13,19H,4-5,8,11H2,1H3,(H2,23,24,25,26).
What are the key properties of 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea?
1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea has a molecular weight of 378.43 g/mol, XLogP of 3.95, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2-methoxyphenyl)-1,6-naphthyridin-2-yl]-3-(oxan-2-yl)urea is sourced from PubChem (CID 22240322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).