C20H23NO5S — CID 22240811
4-benzyl-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid (PubChem CID 22240811) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 4-benzyl-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 4-benzyl-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 22240811 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-benzyl-1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(Cc3ccccc3)(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C20H23NO5S/c1-26-17-7-9-18(10-8-17)27(24,25)21-13-11-20(12-14-21,19(22)23)15-16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,22,23) |
| InChIKey | SVVXHJBPCMAEOE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |