About 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid
2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid (PubChem CID 22241531) has the molecular formula C26H21F2NO5
and a molecular weight of 465.45 g/mol. Its IUPAC name is 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid |
| PubChem CID | 22241531 |
| Molecular Formula | C26H21F2NO5 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid |
| SMILES | Cc1cccc(COc2cccc(OCc3ccc4cc(F)cc(F)c4n3)c2)c1OCC(=O)O |
| InChI | InChI=1S/C26H21F2NO5/c1-16-4-2-5-18(26(16)34-15-24(30)31)13-32-21-6-3-7-22(12-21)33-14-20-9-8-17-10-19(27)11-23(28)25(17)29-20/h2-12H,13-15H2,1H3,(H,30,31) |
| InChIKey | FZOKDOIBEPOFEM-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid?
The IUPAC name of 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid (CID 22241531) is 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid.
What is the SMILES notation for 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid?
The canonical SMILES for 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid is Cc1cccc(COc2cccc(OCc3ccc4cc(F)cc(F)c4n3)c2)c1OCC(=O)O.
What is the InChIKey of 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid?
The InChIKey is FZOKDOIBEPOFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21F2NO5/c1-16-4-2-5-18(26(16)34-15-24(30)31)13-32-21-6-3-7-22(12-21)33-14-20-9-8-17-10-19(27)11-23(28)25(17)29-20/h2-12H,13-15H2,1H3,(H,30,31).
What are the key properties of 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid?
2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid has a molecular weight of 465.45 g/mol, XLogP of 5.44, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid is sourced from PubChem (CID 22241531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).