About (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid
(E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid (PubChem CID 22242044) has the molecular formula C13H18O5
and a molecular weight of 254.28 g/mol. Its IUPAC name is (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid.
Molecular Properties
| Compound Name | (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid |
| PubChem CID | 22242044 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid |
| SMILES | COC(=O)C(CC/C=C/C1CC=CCO1)C(=O)O |
| InChI | InChI=1S/C13H18O5/c1-17-13(16)11(12(14)15)8-3-2-6-10-7-4-5-9-18-10/h2,4-6,10-11H,3,7-9H2,1H3,(H,14,15)/b6-2+ |
| InChIKey | UBWUNDGETIDBHP-QHHAFSJGSA-N |
| XLogP | 1.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid?
The IUPAC name of (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid (CID 22242044) is (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid.
What is the SMILES notation for (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid?
The canonical SMILES for (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid is COC(=O)C(CC/C=C/C1CC=CCO1)C(=O)O.
What is the InChIKey of (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid?
The InChIKey is UBWUNDGETIDBHP-QHHAFSJGSA-N. The full InChI is InChI=1S/C13H18O5/c1-17-13(16)11(12(14)15)8-3-2-6-10-7-4-5-9-18-10/h2,4-6,10-11H,3,7-9H2,1H3,(H,14,15)/b6-2+.
What are the key properties of (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid?
(E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid has a molecular weight of 254.28 g/mol, XLogP of 1.54, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-(3,6-dihydro-2H-pyran-2-yl)-2-methoxycarbonylhex-5-enoic acid is sourced from PubChem (CID 22242044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).