About CID 22242113
CID 22242113 (PubChem CID 22242113) has the molecular formula C12H27O2Si
and a molecular weight of 231.43 g/mol.
Molecular Properties
| Compound Name | CID 22242113 |
| PubChem CID | 22242113 |
| Molecular Formula | C12H27O2Si |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | — |
| SMILES | CCC(C)O[Si](CC(C)C)OC(C)CC |
| InChI | InChI=1S/C12H27O2Si/c1-7-11(5)13-15(9-10(3)4)14-12(6)8-2/h10-12H,7-9H2,1-6H3 |
| InChIKey | LUMNAFSVIKLCKK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22242113 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22242113?
The IUPAC name of CID 22242113 (CID 22242113) is not available.
What is the SMILES notation for CID 22242113?
The canonical SMILES for CID 22242113 is CCC(C)O[Si](CC(C)C)OC(C)CC.
What is the InChIKey of CID 22242113?
The InChIKey is LUMNAFSVIKLCKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O2Si/c1-7-11(5)13-15(9-10(3)4)14-12(6)8-2/h10-12H,7-9H2,1-6H3.
What are the key properties of CID 22242113?
CID 22242113 has a molecular weight of 231.43 g/mol, XLogP of 3.76, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22242113 is sourced from PubChem (CID 22242113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).