About 4-hydroxy-2,3-dimethylbutanamide
4-hydroxy-2,3-dimethylbutanamide (PubChem CID 22242529) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dimethylbutanamide |
| PubChem CID | 22242529 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 4-hydroxy-2,3-dimethylbutanamide |
| SMILES | CC(CO)C(C)C(N)=O |
| InChI | InChI=1S/C6H13NO2/c1-4(3-8)5(2)6(7)9/h4-5,8H,3H2,1-2H3,(H2,7,9) |
| InChIKey | BNZZCHWGHWFPRI-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-2,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dimethylbutanamide?
The IUPAC name of 4-hydroxy-2,3-dimethylbutanamide (CID 22242529) is 4-hydroxy-2,3-dimethylbutanamide.
What is the SMILES notation for 4-hydroxy-2,3-dimethylbutanamide?
The canonical SMILES for 4-hydroxy-2,3-dimethylbutanamide is CC(CO)C(C)C(N)=O.
What is the InChIKey of 4-hydroxy-2,3-dimethylbutanamide?
The InChIKey is BNZZCHWGHWFPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-4(3-8)5(2)6(7)9/h4-5,8H,3H2,1-2H3,(H2,7,9).
What are the key properties of 4-hydroxy-2,3-dimethylbutanamide?
4-hydroxy-2,3-dimethylbutanamide has a molecular weight of 131.17 g/mol, XLogP of -0.26, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethylbutanamide is sourced from PubChem (CID 22242529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).