C27H31N3O3SSi — CID 22242718
1-[[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 22242718) has the molecular formula C27H31N3O3SSi and a molecular weight of 505.72 g/mol. Its IUPAC name is 1-[[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 22242718 |
| Molecular Formula | C27H31N3O3SSi |
| Molecular Weight | 505.72 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 1-[[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)[Si](OC1CN(c2nc(CN3C(=O)CCC3=O)cs2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N3O3SSi/c1-27(2,3)35(22-10-6-4-7-11-22,23-12-8-5-9-13-23)33-21-17-29(18-21)26-28-20(19-34-26)16-30-24(31)14-15-25(30)32/h4-13,19,21H,14-18H2,1-3H3 |
| InChIKey | DWRSZTKEPLZXGD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|