About 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide
2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (PubChem CID 22242729) has the molecular formula C24H29N3O2SSi
and a molecular weight of 451.67 g/mol. Its IUPAC name is 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 22242729 |
| Molecular Formula | C24H29N3O2SSi |
| Molecular Weight | 451.67 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(C)[Si](OC1CCN(c2nc(C(N)=O)cs2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2SSi/c1-24(2,3)31(19-10-6-4-7-11-19,20-12-8-5-9-13-20)29-18-14-15-27(16-18)23-26-21(17-30-23)22(25)28/h4-13,17-18H,14-16H2,1-3H3,(H2,25,28) |
| InChIKey | AOPYAHZFSCCUBB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.67 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide (CID 22242729) is 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide is CC(C)(C)[Si](OC1CCN(c2nc(C(N)=O)cs2)C1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide?
The InChIKey is AOPYAHZFSCCUBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O2SSi/c1-24(2,3)31(19-10-6-4-7-11-19,20-12-8-5-9-13-20)29-18-14-15-27(16-18)23-26-21(17-30-23)22(25)28/h4-13,17-18H,14-16H2,1-3H3,(H2,25,28).
What are the key properties of 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide?
2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide has a molecular weight of 451.67 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[tert-butyl(diphenyl)silyl]oxypyrrolidin-1-yl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 22242729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).