C15H12F3N3O4 — CID 22244218
3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid (PubChem CID 22244218) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is 3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid.
| Compound Name | 3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
|---|---|
| PubChem CID | 22244218 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3,5-dioxo-4-[3-(trifluoromethyl)phenyl]-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxylic acid |
| SMILES | O=C1C2C3CC(CN3C(=O)O)N2C(=O)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N3O4/c16-15(17,18)7-2-1-3-8(4-7)21-12(22)11-10-5-9(20(11)13(21)23)6-19(10)14(24)25/h1-4,9-11H,5-6H2,(H,24,25) |
| InChIKey | JJGRAQLGOVFIPJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|