C19H14F3N3O3 — CID 22244239
4-naphthalen-1-yl-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 22244239) has the molecular formula C19H14F3N3O3 and a molecular weight of 389.33 g/mol. Its IUPAC name is 4-naphthalen-1-yl-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-naphthalen-1-yl-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 22244239 |
| Molecular Formula | C19H14F3N3O3 |
| Molecular Weight | 389.33 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 4-naphthalen-1-yl-8-(2,2,2-trifluoroacetyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(CN3C(=O)C(F)(F)F)N2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C19H14F3N3O3/c20-19(21,22)17(27)23-9-11-8-14(23)15-16(26)25(18(28)24(11)15)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14-15H,8-9H2 |
| InChIKey | METPXNRAWGICRK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|