C11H15N3O3 — CID 22244288
8-(2-methylpropanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 22244288) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is 8-(2-methylpropanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 8-(2-methylpropanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 22244288 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 8-(2-methylpropanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | CC(C)C(=O)N1CC2CC1C1C(=O)NC(=O)N21 |
| InChI | InChI=1S/C11H15N3O3/c1-5(2)10(16)13-4-6-3-7(13)8-9(15)12-11(17)14(6)8/h5-8H,3-4H2,1-2H3,(H,12,15,17) |
| InChIKey | UPJSPEQXFIEWNV-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|