C25H18FN5O3 — CID 22244313
4-(4-cyanonaphthalen-1-yl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide (PubChem CID 22244313) has the molecular formula C25H18FN5O3 and a molecular weight of 455.45 g/mol. Its IUPAC name is 4-(4-cyanonaphthalen-1-yl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide.
| Compound Name | 4-(4-cyanonaphthalen-1-yl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
|---|---|
| PubChem CID | 22244313 |
| Molecular Formula | C25H18FN5O3 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 4-(4-cyanonaphthalen-1-yl)-N-(4-fluorophenyl)-3,5-dioxo-2,4,8-triazatricyclo[5.2.1.02,6]decane-8-carboxamide |
| SMILES | N#Cc1ccc(N2C(=O)C3C4CC(CN4C(=O)Nc4ccc(F)cc4)N3C2=O)c2ccccc12 |
| InChI | InChI=1S/C25H18FN5O3/c26-15-6-8-16(9-7-15)28-24(33)29-13-17-11-21(29)22-23(32)31(25(34)30(17)22)20-10-5-14(12-27)18-3-1-2-4-19(18)20/h1-10,17,21-22H,11,13H2,(H,28,33) |
| InChIKey | KDHKYVJCEFIJBD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|