C22H34N6 — CID 22244847
1,1-diphenylguanidine;1,1,2,3-tetraethylguanidine (PubChem CID 22244847) has the molecular formula C22H34N6 and a molecular weight of 382.56 g/mol. Its IUPAC name is 1,1-diphenylguanidine;1,1,2,3-tetraethylguanidine.
| Compound Name | 1,1-diphenylguanidine;1,1,2,3-tetraethylguanidine |
|---|---|
| PubChem CID | 22244847 |
| Molecular Formula | C22H34N6 |
| Molecular Weight | 382.56 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | 1,1-diphenylguanidine;1,1,2,3-tetraethylguanidine |
| SMILES | CC/N=C(/NCC)N(CC)CC.[H]/N=C(\N)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N3.C9H21N3/c14-13(15)16(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-10-9(11-6-2)12(7-3)8-4/h1-10H,(H3,14,15);5-8H2,1-4H3,(H,10,11) |
| InChIKey | ABGMPSLCXWDJNS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|