About (2-chlorophenyl)methyl 4-methylbenzenesulfonate
(2-chlorophenyl)methyl 4-methylbenzenesulfonate (PubChem CID 22244909) has the molecular formula C14H13ClO3S
and a molecular weight of 296.77 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | (2-chlorophenyl)methyl 4-methylbenzenesulfonate |
| PubChem CID | 22244909 |
| Molecular Formula | C14H13ClO3S |
| Molecular Weight | 296.77 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | (2-chlorophenyl)methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C14H13ClO3S/c1-11-6-8-13(9-7-11)19(16,17)18-10-12-4-2-3-5-14(12)15/h2-9H,10H2,1H3 |
| InChIKey | YSVVBXCXZKBKGE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.77 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl)methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)methyl 4-methylbenzenesulfonate?
The IUPAC name of (2-chlorophenyl)methyl 4-methylbenzenesulfonate (CID 22244909) is (2-chlorophenyl)methyl 4-methylbenzenesulfonate.
What is the SMILES notation for (2-chlorophenyl)methyl 4-methylbenzenesulfonate?
The canonical SMILES for (2-chlorophenyl)methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCc2ccccc2Cl)cc1.
What is the InChIKey of (2-chlorophenyl)methyl 4-methylbenzenesulfonate?
The InChIKey is YSVVBXCXZKBKGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClO3S/c1-11-6-8-13(9-7-11)19(16,17)18-10-12-4-2-3-5-14(12)15/h2-9H,10H2,1H3.
What are the key properties of (2-chlorophenyl)methyl 4-methylbenzenesulfonate?
(2-chlorophenyl)methyl 4-methylbenzenesulfonate has a molecular weight of 296.77 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 22244909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).