C3Br4F2O — CID 22245239
1,1,1,3-tetrabromo-3,3-difluoropropan-2-one (PubChem CID 22245239) has the molecular formula C3Br4F2O and a molecular weight of 409.64 g/mol. Its IUPAC name is 1,1,1,3-tetrabromo-3,3-difluoropropan-2-one.
| Compound Name | 1,1,1,3-tetrabromo-3,3-difluoropropan-2-one |
|---|---|
| PubChem CID | 22245239 |
| Molecular Formula | C3Br4F2O |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 405.67 |
| IUPAC Name | 1,1,1,3-tetrabromo-3,3-difluoropropan-2-one |
| SMILES | O=C(C(F)(F)Br)C(Br)(Br)Br |
| InChI | InChI=1S/C3Br4F2O/c4-2(5,6)1(10)3(7,8)9 |
| InChIKey | UTMPBANNTJAYIT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|