About 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole
2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole (PubChem CID 22245701) has the molecular formula C9H14N4S
and a molecular weight of 210.31 g/mol. Its IUPAC name is 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole |
| PubChem CID | 22245701 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole |
| SMILES | c1nnc(N2CCN3CCC2CC3)s1 |
| InChI | InChI=1S/C9H14N4S/c1-3-12-4-2-8(1)13(6-5-12)9-11-10-7-14-9/h7-8H,1-6H2 |
| InChIKey | CNDJXRFLZRKMJL-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole?
The IUPAC name of 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole (CID 22245701) is 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole?
The canonical SMILES for 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole is c1nnc(N2CCN3CCC2CC3)s1.
What is the InChIKey of 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole?
The InChIKey is CNDJXRFLZRKMJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4S/c1-3-12-4-2-8(1)13(6-5-12)9-11-10-7-14-9/h7-8H,1-6H2.
What are the key properties of 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole?
2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole has a molecular weight of 210.31 g/mol, XLogP of 0.82, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-1,3,4-thiadiazole is sourced from PubChem (CID 22245701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).