C29H43N5O3 — CID 22245717
N-(4-amino-2,3,5,6-tetramethylphenyl)-2-[4-[[2-(4-amino-2,3,5-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]acetamide (PubChem CID 22245717) has the molecular formula C29H43N5O3 and a molecular weight of 509.70 g/mol. Its IUPAC name is N-(4-amino-2,3,5,6-tetramethylphenyl)-2-[4-[[2-(4-amino-2,3,5-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]acetamide.
| Compound Name | N-(4-amino-2,3,5,6-tetramethylphenyl)-2-[4-[[2-(4-amino-2,3,5-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 22245717 |
| Molecular Formula | C29H43N5O3 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.34 |
| IUPAC Name | N-(4-amino-2,3,5,6-tetramethylphenyl)-2-[4-[[2-(4-amino-2,3,5-trimethylphenoxy)acetyl]-methylamino]piperidin-1-yl]acetamide |
| SMILES | Cc1cc(OCC(=O)N(C)C2CCN(CC(=O)Nc3c(C)c(C)c(N)c(C)c3C)CC2)c(C)c(C)c1N |
| InChI | InChI=1S/C29H43N5O3/c1-16-13-24(17(2)18(3)27(16)30)37-15-26(36)33(8)23-9-11-34(12-10-23)14-25(35)32-29-21(6)19(4)28(31)20(5)22(29)7/h13,23H,9-12,14-15,30-31H2,1-8H3,(H,32,35) |
| InChIKey | DFBMUAJMAKAIFP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|