C32H34N2O6S — CID 22246162
4-[2-[(E)-3-[[3-(4-hydroxy-2,6-dimethyloxan-4-yl)phenyl]methoxy]prop-1-enyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide (PubChem CID 22246162) has the molecular formula C32H34N2O6S and a molecular weight of 574.70 g/mol. Its IUPAC name is 4-[2-[(E)-3-[[3-(4-hydroxy-2,6-dimethyloxan-4-yl)phenyl]methoxy]prop-1-enyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide.
| Compound Name | 4-[2-[(E)-3-[[3-(4-hydroxy-2,6-dimethyloxan-4-yl)phenyl]methoxy]prop-1-enyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22246162 |
| Molecular Formula | C32H34N2O6S |
| Molecular Weight | 574.70 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 4-[2-[(E)-3-[[3-(4-hydroxy-2,6-dimethyloxan-4-yl)phenyl]methoxy]prop-1-enyl]-4-phenyl-1,3-oxazol-5-yl]benzenesulfonamide |
| SMILES | CC1CC(O)(c2cccc(COC/C=C/c3nc(-c4ccccc4)c(-c4ccc(S(N)(=O)=O)cc4)o3)c2)CC(C)O1 |
| InChI | InChI=1S/C32H34N2O6S/c1-22-19-32(35,20-23(2)39-22)27-11-6-8-24(18-27)21-38-17-7-12-29-34-30(25-9-4-3-5-10-25)31(40-29)26-13-15-28(16-14-26)41(33,36)37/h3-16,18,22-23,35H,17,19-21H2,1-2H3,(H2,33,36,37)/b12-7+ |
| InChIKey | SUGNYPLSMVQIKU-KPKJPENVSA-N |
| XLogP | 5.66 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|