C29H37NO6 — CID 22246461
1-phenylethyl 2-[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]-2-oxoacetate (PubChem CID 22246461) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is 1-phenylethyl 2-[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]-2-oxoacetate.
| Compound Name | 1-phenylethyl 2-[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 22246461 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 1-phenylethyl 2-[4-(3-cyclopentyloxy-4-methoxyphenyl)-3-(1-hydroxyethyl)-3-methylpyrrolidin-1-yl]-2-oxoacetate |
| SMILES | COc1ccc(C2CN(C(=O)C(=O)OC(C)c3ccccc3)CC2(C)C(C)O)cc1OC1CCCC1 |
| InChI | InChI=1S/C29H37NO6/c1-19(21-10-6-5-7-11-21)35-28(33)27(32)30-17-24(29(3,18-30)20(2)31)22-14-15-25(34-4)26(16-22)36-23-12-8-9-13-23/h5-7,10-11,14-16,19-20,23-24,31H,8-9,12-13,17-18H2,1-4H3 |
| InChIKey | OTUPAOBAWWFKIW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|