C11H12F10O3 — CID 22247105
3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane (PubChem CID 22247105) has the molecular formula C11H12F10O3 and a molecular weight of 382.19 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane.
| Compound Name | 3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane |
|---|---|
| PubChem CID | 22247105 |
| Molecular Formula | C11H12F10O3 |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 3-(2,2,3,3,4,4,4-heptafluorobutoxymethyl)-3-(2,2,2-trifluoroethoxymethyl)oxetane |
| SMILES | FC(F)(F)COCC1(COCC(F)(F)C(F)(F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C11H12F10O3/c12-8(13,10(17,18)11(19,20)21)5-23-3-7(1-22-2-7)4-24-6-9(14,15)16/h1-6H2 |
| InChIKey | MVXDQPWDKQXWJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|