C13H12F14O3 — CID 22247108
3,3-bis(2,2,3,3,4,4,4-heptafluorobutoxymethyl)oxetane (PubChem CID 22247108) has the molecular formula C13H12F14O3 and a molecular weight of 482.21 g/mol. Its IUPAC name is 3,3-bis(2,2,3,3,4,4,4-heptafluorobutoxymethyl)oxetane.
| Compound Name | 3,3-bis(2,2,3,3,4,4,4-heptafluorobutoxymethyl)oxetane |
|---|---|
| PubChem CID | 22247108 |
| Molecular Formula | C13H12F14O3 |
| Molecular Weight | 482.21 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 3,3-bis(2,2,3,3,4,4,4-heptafluorobutoxymethyl)oxetane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)COCC1(COCC(F)(F)C(F)(F)C(F)(F)F)COC1 |
| InChI | InChI=1S/C13H12F14O3/c14-8(15,10(18,19)12(22,23)24)5-29-3-7(1-28-2-7)4-30-6-9(16,17)11(20,21)13(25,26)27/h1-6H2 |
| InChIKey | QKFCXWZBHYFIHE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.21 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|