About 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 2224719) has the molecular formula C17H15F3N2O5S
and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 2224719 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(C(F)(F)F)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15F3N2O5S/c1-28(24,25)22(13-6-7-14-15(8-13)27-10-26-14)9-16(23)21-12-4-2-11(3-5-12)17(18,19)20/h2-8H,9-10H2,1H3,(H,21,23) |
| InChIKey | NGWHOWILQNGTQB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide (CID 2224719) is 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide is CS(=O)(=O)N(CC(=O)Nc1ccc(C(F)(F)F)cc1)c1ccc2c(c1)OCO2.
What is the InChIKey of 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide?
The InChIKey is NGWHOWILQNGTQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N2O5S/c1-28(24,25)22(13-6-7-14-15(8-13)27-10-26-14)9-16(23)21-12-4-2-11(3-5-12)17(18,19)20/h2-8H,9-10H2,1H3,(H,21,23).
What are the key properties of 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide?
2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide has a molecular weight of 416.38 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-benzodioxol-5-yl(methylsulfonyl)amino]-N-[4-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 2224719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).