C21H21FO3 — CID 22247223
10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one (PubChem CID 22247223) has the molecular formula C21H21FO3 and a molecular weight of 340.39 g/mol. Its IUPAC name is 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one.
| Compound Name | 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
|---|---|
| PubChem CID | 22247223 |
| Molecular Formula | C21H21FO3 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-6-fluorotricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-9-one |
| SMILES | CC1(C)OCC(CC2C(=O)c3cc(F)ccc3Cc3ccccc32)O1 |
| InChI | InChI=1S/C21H21FO3/c1-21(2)24-12-16(25-21)11-19-17-6-4-3-5-13(17)9-14-7-8-15(22)10-18(14)20(19)23/h3-8,10,16,19H,9,11-12H2,1-2H3 |
| InChIKey | GZVDCEFZGMFEFK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |