About 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid
4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid (PubChem CID 22247514) has the molecular formula C31H24O3S2
and a molecular weight of 508.66 g/mol. Its IUPAC name is 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid |
| PubChem CID | 22247514 |
| Molecular Formula | C31H24O3S2 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid |
| SMILES | Cc1cc(-c2ccccc2)c(S(=O)(=O)O)c(-c2ccccc2)c1-c1ccc(Sc2ccccc2)cc1 |
| InChI | InChI=1S/C31H24O3S2/c1-22-21-28(23-11-5-2-6-12-23)31(36(32,33)34)30(24-13-7-3-8-14-24)29(22)25-17-19-27(20-18-25)35-26-15-9-4-10-16-26/h2-21H,1H3,(H,32,33,34) |
| InChIKey | XKUAZZJAXGQCCB-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid?
The IUPAC name of 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid (CID 22247514) is 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid.
What is the SMILES notation for 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid?
The canonical SMILES for 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid is Cc1cc(-c2ccccc2)c(S(=O)(=O)O)c(-c2ccccc2)c1-c1ccc(Sc2ccccc2)cc1.
What is the InChIKey of 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid?
The InChIKey is XKUAZZJAXGQCCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H24O3S2/c1-22-21-28(23-11-5-2-6-12-23)31(36(32,33)34)30(24-13-7-3-8-14-24)29(22)25-17-19-27(20-18-25)35-26-15-9-4-10-16-26/h2-21H,1H3,(H,32,33,34).
What are the key properties of 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid?
4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid has a molecular weight of 508.66 g/mol, XLogP of 8.39, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,6-diphenyl-3-(4-phenylsulfanylphenyl)benzenesulfonic acid is sourced from PubChem (CID 22247514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).