About 4-ethenylbenzene-1,2,3-triol
4-ethenylbenzene-1,2,3-triol (PubChem CID 22247516) has the molecular formula C8H8O3
and a molecular weight of 152.15 g/mol. Its IUPAC name is 4-ethenylbenzene-1,2,3-triol.
Molecular Properties
| Compound Name | 4-ethenylbenzene-1,2,3-triol |
| PubChem CID | 22247516 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 4-ethenylbenzene-1,2,3-triol |
| SMILES | C=Cc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C8H8O3/c1-2-5-3-4-6(9)8(11)7(5)10/h2-4,9-11H,1H2 |
| InChIKey | HQWCOSNNGHBCQE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenylbenzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenylbenzene-1,2,3-triol?
The IUPAC name of 4-ethenylbenzene-1,2,3-triol (CID 22247516) is 4-ethenylbenzene-1,2,3-triol.
What is the SMILES notation for 4-ethenylbenzene-1,2,3-triol?
The canonical SMILES for 4-ethenylbenzene-1,2,3-triol is C=Cc1ccc(O)c(O)c1O.
What is the InChIKey of 4-ethenylbenzene-1,2,3-triol?
The InChIKey is HQWCOSNNGHBCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3/c1-2-5-3-4-6(9)8(11)7(5)10/h2-4,9-11H,1H2.
What are the key properties of 4-ethenylbenzene-1,2,3-triol?
4-ethenylbenzene-1,2,3-triol has a molecular weight of 152.15 g/mol, XLogP of 1.45, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenylbenzene-1,2,3-triol is sourced from PubChem (CID 22247516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).