C23H38Cl2N4O3S — CID 22247575
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;2,2,6,6-tetramethylheptane-3,5-dione;chloride;hydrochloride (PubChem CID 22247575) has the molecular formula C23H38Cl2N4O3S and a molecular weight of 521.56 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;2,2,6,6-tetramethylheptane-3,5-dione;chloride;hydrochloride.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;2,2,6,6-tetramethylheptane-3,5-dione;chloride;hydrochloride |
|---|---|
| PubChem CID | 22247575 |
| Molecular Formula | C23H38Cl2N4O3S |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;2,2,6,6-tetramethylheptane-3,5-dione;chloride;hydrochloride |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C.Cc1ncc(C[n+]2csc(CCO)c2C)c(N)n1.Cl.[Cl-] |
| InChI | InChI=1S/C12H17N4OS.C11H20O2.2ClH/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;1-10(2,3)8(12)7-9(13)11(4,5)6;;/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);7H2,1-6H3;2*1H/q+1;;;/p-1 |
| InChIKey | DXRDOWOLBWKFSZ-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|