C23H33N5O2S — CID 22248194
1-methyl-3-[2-[[1-[[3-[(2-methylpropan-2-yl)oxy]pyrazin-2-yl]methyl]piperidin-4-yl]methoxy]phenyl]thiourea (PubChem CID 22248194) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-methyl-3-[2-[[1-[[3-[(2-methylpropan-2-yl)oxy]pyrazin-2-yl]methyl]piperidin-4-yl]methoxy]phenyl]thiourea.
| Compound Name | 1-methyl-3-[2-[[1-[[3-[(2-methylpropan-2-yl)oxy]pyrazin-2-yl]methyl]piperidin-4-yl]methoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 22248194 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-methyl-3-[2-[[1-[[3-[(2-methylpropan-2-yl)oxy]pyrazin-2-yl]methyl]piperidin-4-yl]methoxy]phenyl]thiourea |
| SMILES | CNC(=S)Nc1ccccc1OCC1CCN(Cc2nccnc2OC(C)(C)C)CC1 |
| InChI | InChI=1S/C23H33N5O2S/c1-23(2,3)30-21-19(25-11-12-26-21)15-28-13-9-17(10-14-28)16-29-20-8-6-5-7-18(20)27-22(31)24-4/h5-8,11-12,17H,9-10,13-16H2,1-4H3,(H2,24,27,31) |
| InChIKey | ACPPMDMEOFTOND-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|