About 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one
6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one (PubChem CID 22248301) has the molecular formula C18H21F2N3O2
and a molecular weight of 349.38 g/mol. Its IUPAC name is 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one.
Molecular Properties
| Compound Name | 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one |
| PubChem CID | 22248301 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one |
| SMILES | O=c1cncc(CCN2CCC(COc3cccc(F)c3F)CC2)[nH]1 |
| InChI | InChI=1S/C18H21F2N3O2/c19-15-2-1-3-16(18(15)20)25-12-13-4-7-23(8-5-13)9-6-14-10-21-11-17(24)22-14/h1-3,10-11,13H,4-9,12H2,(H,22,24) |
| InChIKey | GDAYKCSNPNHSLQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one?
The IUPAC name of 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one (CID 22248301) is 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one.
What is the SMILES notation for 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one?
The canonical SMILES for 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one is O=c1cncc(CCN2CCC(COc3cccc(F)c3F)CC2)[nH]1.
What is the InChIKey of 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one?
The InChIKey is GDAYKCSNPNHSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N3O2/c19-15-2-1-3-16(18(15)20)25-12-13-4-7-23(8-5-13)9-6-14-10-21-11-17(24)22-14/h1-3,10-11,13H,4-9,12H2,(H,22,24).
What are the key properties of 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one?
6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one has a molecular weight of 349.38 g/mol, XLogP of 2.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-[4-[(2,3-difluorophenoxy)methyl]piperidin-1-yl]ethyl]-1H-pyrazin-2-one is sourced from PubChem (CID 22248301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).