C15H18F3NO — CID 22248330
1-(4-methylpiperidin-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanone (PubChem CID 22248330) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is 1-(4-methylpiperidin-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(4-methylpiperidin-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 22248330 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(4-methylpiperidin-4-yl)-2-[2-(trifluoromethyl)phenyl]ethanone |
| SMILES | CC1(C(=O)Cc2ccccc2C(F)(F)F)CCNCC1 |
| InChI | InChI=1S/C15H18F3NO/c1-14(6-8-19-9-7-14)13(20)10-11-4-2-3-5-12(11)15(16,17)18/h2-5,19H,6-10H2,1H3 |
| InChIKey | VKQFXGIHKMVQKC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |