C18H20FN3O6 — CID 22248542
3-[[3-[(2-fluorophenoxy)methyl]pyrrolidin-1-yl]methyl]-1H-pyrazin-2-one;oxalic acid (PubChem CID 22248542) has the molecular formula C18H20FN3O6 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-[[3-[(2-fluorophenoxy)methyl]pyrrolidin-1-yl]methyl]-1H-pyrazin-2-one;oxalic acid.
| Compound Name | 3-[[3-[(2-fluorophenoxy)methyl]pyrrolidin-1-yl]methyl]-1H-pyrazin-2-one;oxalic acid |
|---|---|
| PubChem CID | 22248542 |
| Molecular Formula | C18H20FN3O6 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[[3-[(2-fluorophenoxy)methyl]pyrrolidin-1-yl]methyl]-1H-pyrazin-2-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=c1[nH]ccnc1CN1CCC(COc2ccccc2F)C1 |
| InChI | InChI=1S/C16H18FN3O2.C2H2O4/c17-13-3-1-2-4-15(13)22-11-12-5-8-20(9-12)10-14-16(21)19-7-6-18-14;3-1(4)2(5)6/h1-4,6-7,12H,5,8-11H2,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | OEMKBPWHAGNZSC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 132.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|