About bis(4-methylpiperazin-1-yl)alumanylium;hydride
bis(4-methylpiperazin-1-yl)alumanylium;hydride (PubChem CID 22248554) has the molecular formula C10H23AlN4
and a molecular weight of 226.30 g/mol. Its IUPAC name is bis(4-methylpiperazin-1-yl)alumanylium;hydride.
Molecular Properties
| Compound Name | bis(4-methylpiperazin-1-yl)alumanylium;hydride |
| PubChem CID | 22248554 |
| Molecular Formula | C10H23AlN4 |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | bis(4-methylpiperazin-1-yl)alumanylium;hydride |
| SMILES | CN1CCN([Al+]N2CCN(C)CC2)CC1.[H-] |
| InChI | InChI=1S/2C5H11N2.Al.H/c2*1-7-4-2-6-3-5-7;;/h2*2-5H2,1H3;;/q2*-1;+3;-1 |
| InChIKey | XUDXBAZTMZMZEK-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(4-methylpiperazin-1-yl)alumanylium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylpiperazin-1-yl)alumanylium;hydride?
The IUPAC name of bis(4-methylpiperazin-1-yl)alumanylium;hydride (CID 22248554) is bis(4-methylpiperazin-1-yl)alumanylium;hydride.
What is the SMILES notation for bis(4-methylpiperazin-1-yl)alumanylium;hydride?
The canonical SMILES for bis(4-methylpiperazin-1-yl)alumanylium;hydride is CN1CCN([Al+]N2CCN(C)CC2)CC1.[H-].
What is the InChIKey of bis(4-methylpiperazin-1-yl)alumanylium;hydride?
The InChIKey is XUDXBAZTMZMZEK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H11N2.Al.H/c2*1-7-4-2-6-3-5-7;;/h2*2-5H2,1H3;;/q2*-1;+3;-1.
What are the key properties of bis(4-methylpiperazin-1-yl)alumanylium;hydride?
bis(4-methylpiperazin-1-yl)alumanylium;hydride has a molecular weight of 226.30 g/mol, XLogP of -0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylpiperazin-1-yl)alumanylium;hydride is sourced from PubChem (CID 22248554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).