About 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine
5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine (PubChem CID 22248899) has the molecular formula C19H25F2N3
and a molecular weight of 333.43 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine |
| PubChem CID | 22248899 |
| Molecular Formula | C19H25F2N3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCc1nc(-c2ccc(F)cc2F)c(CC)nc1NC(CC)CC |
| InChI | InChI=1S/C19H25F2N3/c1-5-13(6-2)22-19-17(8-4)23-18(16(7-3)24-19)14-10-9-12(20)11-15(14)21/h9-11,13H,5-8H2,1-4H3,(H,22,24) |
| InChIKey | QHSWFCRPJLCPCN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The IUPAC name of 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine (CID 22248899) is 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine.
What is the SMILES notation for 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The canonical SMILES for 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine is CCc1nc(-c2ccc(F)cc2F)c(CC)nc1NC(CC)CC.
What is the InChIKey of 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
The InChIKey is QHSWFCRPJLCPCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25F2N3/c1-5-13(6-2)22-19-17(8-4)23-18(16(7-3)24-19)14-10-9-12(20)11-15(14)21/h9-11,13H,5-8H2,1-4H3,(H,22,24).
What are the key properties of 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine?
5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine has a molecular weight of 333.43 g/mol, XLogP of 5.15, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)-3,6-diethyl-N-pentan-3-ylpyrazin-2-amine is sourced from PubChem (CID 22248899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).