C8H14N2 — CID 22248991
N,N,4-trimethyl-1,2-dihydropyridin-2-amine (PubChem CID 22248991) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N,N,4-trimethyl-1,2-dihydropyridin-2-amine.
| Compound Name | N,N,4-trimethyl-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 22248991 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,N,4-trimethyl-1,2-dihydropyridin-2-amine |
| SMILES | CC1=CC(N(C)C)NC=C1 |
| InChI | InChI=1S/C8H14N2/c1-7-4-5-9-8(6-7)10(2)3/h4-6,8-9H,1-3H3 |
| InChIKey | RARHRZPYMRVIBQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |