About 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine
5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine (PubChem CID 22249051) has the molecular formula C17H21Cl2N3O2
and a molecular weight of 370.28 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine.
Molecular Properties
| Compound Name | 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine |
| PubChem CID | 22249051 |
| Molecular Formula | C17H21Cl2N3O2 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine |
| SMILES | CCC(CC)Nc1nc(OC)c(-c2ccc(Cl)cc2Cl)nc1OC |
| InChI | InChI=1S/C17H21Cl2N3O2/c1-5-11(6-2)20-15-17(24-4)21-14(16(22-15)23-3)12-8-7-10(18)9-13(12)19/h7-9,11H,5-6H2,1-4H3,(H,20,22) |
| InChIKey | XGBBOXTWDBQGMS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine?
The IUPAC name of 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine (CID 22249051) is 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine?
The canonical SMILES for 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine is CCC(CC)Nc1nc(OC)c(-c2ccc(Cl)cc2Cl)nc1OC.
What is the InChIKey of 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine?
The InChIKey is XGBBOXTWDBQGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21Cl2N3O2/c1-5-11(6-2)20-15-17(24-4)21-14(16(22-15)23-3)12-8-7-10(18)9-13(12)19/h7-9,11H,5-6H2,1-4H3,(H,20,22).
What are the key properties of 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine?
5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine has a molecular weight of 370.28 g/mol, XLogP of 5.07, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-3,6-dimethoxy-N-pentan-3-ylpyrazin-2-amine is sourced from PubChem (CID 22249051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).