C29H32F5N5O2 — CID 22249388
2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide (PubChem CID 22249388) has the molecular formula C29H32F5N5O2 and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22249388 |
| Molecular Formula | C29H32F5N5O2 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[4-(1,1,2,2,2-pentafluoroethyl)phenyl]pyridine-3-carboxamide |
| SMILES | CN1CCC(CCCOc2cc(CNc3ncccc3C(=O)Nc3ccc(C(F)(F)C(F)(F)F)cc3)ccn2)CC1 |
| InChI | InChI=1S/C29H32F5N5O2/c1-39-15-11-20(12-16-39)4-3-17-41-25-18-21(10-14-35-25)19-37-26-24(5-2-13-36-26)27(40)38-23-8-6-22(7-9-23)28(30,31)29(32,33)34/h2,5-10,13-14,18,20H,3-4,11-12,15-17,19H2,1H3,(H,36,37)(H,38,40) |
| InChIKey | LJIIHWGLUXQUAG-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|