C30H34N4 — CID 22249480
3-benzyl-4-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22249480) has the molecular formula C30H34N4 and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-benzyl-4-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-benzyl-4-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22249480 |
| Molecular Formula | C30H34N4 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-benzyl-4-butyl-7,11-dimethyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | CCCCc1cc2c(C)nc3c(-c4c(C)cc(C)cc4C)c(C)nn3c2n1Cc1ccccc1 |
| InChI | InChI=1S/C30H34N4/c1-7-8-14-25-17-26-22(5)31-29-28(27-20(3)15-19(2)16-21(27)4)23(6)32-34(29)30(26)33(25)18-24-12-10-9-11-13-24/h9-13,15-17H,7-8,14,18H2,1-6H3 |
| InChIKey | RUBFEABULSUDDT-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |