C26H32N4O — CID 22249481
3-(3-methoxypropyl)-7,11-dimethyl-4-prop-2-enyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 22249481) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-7,11-dimethyl-4-prop-2-enyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 3-(3-methoxypropyl)-7,11-dimethyl-4-prop-2-enyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 22249481 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-(3-methoxypropyl)-7,11-dimethyl-4-prop-2-enyl-10-(2,4,6-trimethylphenyl)-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | C=CCc1cc2c(C)nc3c(-c4c(C)cc(C)cc4C)c(C)nn3c2n1CCCOC |
| InChI | InChI=1S/C26H32N4O/c1-8-10-21-15-22-19(5)27-25-24(23-17(3)13-16(2)14-18(23)4)20(6)28-30(25)26(22)29(21)11-9-12-31-7/h8,13-15H,1,9-12H2,2-7H3 |
| InChIKey | WXYQKOLBKBNZNE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|